Introduction:Basic information about CAS 88022-48-4|2,3,4,5,5,5-Hexafluoro-4-trifluoromethyl-2-pentenoyl fluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,4,5,5,5-Hexafluoro-4-trifluoromethyl-2-pentenoyl fluoride |
|---|
| CAS Number | 88022-48-4 | Molecular Weight | 278.04800 |
|---|
| Density | 1.611g/cm3 | Boiling Point | 85-86ºC |
|---|
| Molecular Formula | C6F10O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 16.6ºC |
|---|
Names
| Name | 2,3,4,5,5,5-Hexafluoro-4-trifluoromethyl-2-pentenoyl fluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.611g/cm3 |
|---|
| Boiling Point | 85-86ºC |
|---|
| Molecular Formula | C6F10O |
|---|
| Molecular Weight | 278.04800 |
|---|
| Flash Point | 16.6ºC |
|---|
| Exact Mass | 277.97900 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.46600 |
|---|
| Index of Refraction | 1.288 |
|---|
| InChIKey | ZDDYAQBRMKIGMY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(F)C(F)=C(F)C(F)(C(F)(F)F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3265 |
|---|
| HS Code | 2916190090 |
|---|
Customs
| HS Code | 2916190090 |
|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|---|
Synonyms
| 4-trifluoromethylperfluoro-2-pentenoic acid fluoride |
| Perfluoro-4-methylpent-2-enoyl fluoride |
| perfluoro-4-methylpent-2-enoic acid fluoride |
| HEXAFLUORO-4-TRIFLUOROMETHYL-2-PENTENOYL FLUORIDE |