Introduction：Basic information about CAS 69497-44-5|Phosphoramidochloridicacid, phenyl-, 4-chlorophenyl ester (9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phosphoramidochloridicacid, phenyl-, 4-chlorophenyl ester (9CI) |
|---|
| CAS Number | 69497-44-5 | Molecular Weight | 302.09300 |
|---|
| Density | 1.45g/cm3 | Boiling Point | 396.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10Cl2NO2P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193.3ºC |
|---|
Names
| Name | N-[chloro-(4-chlorophenoxy)phosphoryl]aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.45g/cm3 |
|---|
| Boiling Point | 396.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10Cl2NO2P |
|---|
| Molecular Weight | 302.09300 |
|---|
| Flash Point | 193.3ºC |
|---|
| Exact Mass | 300.98300 |
|---|
| PSA | 48.14000 |
|---|
| LogP | 5.25080 |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | JXMYVMSKADODRN-UHFFFAOYSA-N |
|---|
| SMILES | O=P(Cl)(Nc1ccccc1)Oc1ccc(Cl)cc1 |
|---|
Synonyms
| p-chlorophenyl N-phenylphosphoramidochloridate |
| p-chlorophenylphosphoranilido chloridate |
| p-Chlorophenyl-N-phenylchlorophosphoramidat |
| 4-chlorophenyl phosphoranilidochloridate |
| N-Phenylamidochloridophosphoric acid 4-chlorophenyl ester |
| 4-CHLOROPHENYL-N-PHENYLPHOSPHORAMIDOCHLORIDATE |
