Introduction：Basic information about CAS 6271-80-3|1-chloro-4-(2-nitrophenyl)benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-chloro-4-(2-nitrophenyl)benzene |
|---|
| CAS Number | 6271-80-3 | Molecular Weight | 233.65000 |
|---|
| Density | 1.308g/cm3 | Boiling Point | 352.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167.1ºC |
|---|
Names
| Name | 1-(4-chlorophenyl)-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.308g/cm3 |
|---|
| Boiling Point | 352.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8ClNO2 |
|---|
| Molecular Weight | 233.65000 |
|---|
| Flash Point | 167.1ºC |
|---|
| Exact Mass | 233.02400 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 4.43840 |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | OMNWKPZIFZJANV-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccccc1-c1ccc(Cl)cc1 |
|---|
Synonyms
| 4-Chloro-2'-nitro-1,1'-biphenyl |
| 1-chloro-4-(2-nitrophenyl)benzene |
| 2-(4-chlorophenyl)nitrobenzene |
| 4'-chloro-2-nitro-biphenyl |
| 4'-Chlor-2-nitro-biphenyl |
