Introduction：Basic information about CAS 568-93-4|Acid Mordant Orange 14, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acid Mordant Orange 14 |
|---|
| CAS Number | 568-93-4 | Molecular Weight | 285.20800 |
|---|
| Density | 1.7g/cm3 | Boiling Point | 473.1ºC at 760mmHg |
|---|
| Molecular Formula | C14H7NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 202.2ºC |
|---|
Names
| Name | 1,2-dihydroxy-3-nitroanthracene-9,10-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7g/cm3 |
|---|
| Boiling Point | 473.1ºC at 760mmHg |
|---|
| Molecular Formula | C14H7NO6 |
|---|
| Molecular Weight | 285.20800 |
|---|
| Flash Point | 202.2ºC |
|---|
| Exact Mass | 285.02700 |
|---|
| PSA | 120.42000 |
|---|
| LogP | 2.30460 |
|---|
| Index of Refraction | 1.759 |
|---|
| InChIKey | XZSUEVFAMOKROK-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)c2c1cc([N+](=O)[O-])c(O)c2O |
|---|
Synonyms
| Alizarin,3-nitro |
| Alizarine Orange A |
| 1,2-dihydroxy-3-nitro-9,10-anthracenedione |
| 3-Nitroalizarin |
| 1,2-Dihydroxy-3-nitro-anthrachinon |
| 1,2-dihydroxy-3-nitro-anthraquinone |
| Alizarin orange |
| C.I. Mordant Orange |
| 3-Nitro-1,2-dihydroxyanthrachinon |
| 3-Nitroalizarine |
| Alizarine orange |
| 3-nitro-1,2-dihydroxy-anthraquinone |
