Introduction:Basic information about CAS 6265-97-0|Phenol,2-(2-benzothiazolyl)-4-chloro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenol,2-(2-benzothiazolyl)-4-chloro- |
|---|
| CAS Number | 6265-97-0 | Molecular Weight | 261.72700 |
|---|
| Density | 1.47g/cm3 | Boiling Point | 349.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8ClNOS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.3ºC |
|---|
Names
| Name | (6Z)-6-(3H-1,3-benzothiazol-2-ylidene)-4-chlorocyclohexa-2,4-dien-1-one |
|---|
Chemical & Physical Properties
| Density | 1.47g/cm3 |
|---|
| Boiling Point | 349.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8ClNOS |
|---|
| Molecular Weight | 261.72700 |
|---|
| Flash Point | 165.3ºC |
|---|
| Exact Mass | 261.00200 |
|---|
| PSA | 61.36000 |
|---|
| LogP | 4.32230 |
|---|
| Index of Refraction | 1.731 |
|---|
| InChIKey | NTSGEVXMOPCWCT-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc(Cl)cc1-c1nc2ccccc2s1 |
|---|