Introduction：Basic information about CAS 62030-34-6|Ethanol,2-(2,4-dinitrophenoxy)-, 1-nitrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethanol,2-(2,4-dinitrophenoxy)-, 1-nitrate |
|---|
| CAS Number | 62030-34-6 | Molecular Weight | 273.15600 |
|---|
| Density | 1.581g/cm3 | Boiling Point | 464.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7N3O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228.4ºC |
|---|
Names
| Name | 2-(2,4-dinitrophenoxy)ethyl nitrate |
|---|
Chemical & Physical Properties
| Density | 1.581g/cm3 |
|---|
| Boiling Point | 464.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7N3O8 |
|---|
| Molecular Weight | 273.15600 |
|---|
| Flash Point | 228.4ºC |
|---|
| Exact Mass | 273.02300 |
|---|
| PSA | 155.92000 |
|---|
| LogP | 2.65970 |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | UTUMHAGEPUQRFP-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])OCCOc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2920909090 |
|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
