CAS 2746-19-2|cis-5-Norbornene-exo-2,3-dicarboxylic anhydride
Introduction:Basic information about CAS 2746-19-2|cis-5-Norbornene-exo-2,3-dicarboxylic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | cis-5-Norbornene-exo-2,3-dicarboxylic anhydride | ||
|---|---|---|---|
| CAS Number | 2746-19-2 | Molecular Weight | 164.158 |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 331.1±42.0 °C at 760 mmHg |
| Molecular Formula | C9H8O3 | Melting Point | 140-145ºC(lit.) |
| MSDS | ChineseUSA | Flash Point | 163.8±25.1 °C |
| Symbol | GHS05, GHS08 | Signal Word | Danger |
Names
| Name | exo-3,6-Methylene-1,2,3,6-tetrahydrophthalic anhydride |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.1±42.0 °C at 760 mmHg |
| Melting Point | 140-145ºC(lit.) |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.158 |
| Flash Point | 163.8±25.1 °C |
| Exact Mass | 164.047348 |
| PSA | 43.37000 |
| LogP | -0.04 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | KNDQHSIWLOJIGP-RNGGSSJXSA-N |
| SMILES | O=C1OC(=O)C2C3C=CC(C3)C12 |
| Storage condition | Refrigerator, Under Inert Atmosphere |
Safety Information
| Symbol | GHS05, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H318-H334 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P342 + P311 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 37/38-41 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
Customs
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
Articles1
More Articles| Occupational asthma caused by himic anhydride. Scand. J. Work. Environ. Health 13(2) , 150-4, (1987) Acid anhydride compounds are reactive chemicals that have been previously associated with immunoglobulin E (IgE) mediated occupational asthma. Twenty workers with exposure to himic anhydride powder us... |
Synonyms
| Nadic Anhydride |
| CIS-5-NORBORNENE-EXO-2,3-DICARBOXYLIC AN |
| 3a,4,7,7a-tetrahydro-4,7-methano-2-benzofuran-1,3-dione |
| endo-5-norbornen-2,3-dicarboxylic acid anhydride |
| CIS-5-NORBORNENE-EXO-2,3-DICARBOXYLIC ANHYDRIDE |
| Bicyclo[2.2.1]-5-heptene-2,3-dicarboxylic Anhydride |
| exo-cis-5-Norbornene-2,3-dicarboxylic anhydride |
| cis-5-Norbornene-endo-2,3-dicarboxylic anhydride |
| Exo-5-norbornene-2,3-dicarboxylic anhydride |
| 3aa,4,7,7aa-Tetrahydro-4a,7a-methanoisobenzofuran-1,3-dione |
| 5-Norbornene-2,3-dicarboxylic anhydride,cis-exo |
| endo-cis-Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic Anhydride |
| norborn-5-ene-2exo,3exo-dicarboxylicacidanhydride |
| Bicyclo[2.2.1]hept-5-ene-exo-2,3-dicarboxylic Anhydride |
| cis-endo-5-Norbornene-2,3-dicarboxylic anhydride |
| 3,6-Endomethylene-1,2,3,6-tetrabydro-cis-phthalic Anhydride |
| (3aR,4R,7S,7aS)-rel-3a,4,7,7a-Tetrahydro-4,7-methanoisobenzofuran-1,3-dione |
| EINECS 220-384-5 |
| exo-3,6-Methylene-1,2,3,6-tetrahydrophthalic anhydride |
| 4-Oxatricyclo[5.2.1.0]dec-8-ene-3,5-dione |
| 4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro- |
| di-exo-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic anhydride |
| 3,6-Endomethylene-D4-tetrahydrophthalic Anhydride |
| MFCD00630580 |
| 3,6-Endomethylene-δ4-tetrahydrophthalic anhydride |
| cis-Norbornene-exo-2,3-dicarboxylic Anhydride |
