Introduction：Basic information about CAS 23279-64-3|Acetamide,N-[2-(4-acetylphenyl)ethyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetamide,N-[2-(4-acetylphenyl)ethyl]- |
|---|
| CAS Number | 23279-64-3 | Molecular Weight | 205.25300 |
|---|
| Density | 1.064g/cm3 | Boiling Point | 428.9ºC at 760mmHg |
|---|
| Molecular Formula | C12H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 182ºC |
|---|
Names
| Name | N-[2-(4-acetyl-phenyl)-ethyl]-acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.064g/cm3 |
|---|
| Boiling Point | 428.9ºC at 760mmHg |
|---|
| Molecular Formula | C12H15NO2 |
|---|
| Molecular Weight | 205.25300 |
|---|
| Flash Point | 182ºC |
|---|
| Exact Mass | 205.11000 |
|---|
| PSA | 46.17000 |
|---|
| LogP | 1.95870 |
|---|
| Vapour Pressure | 1.46E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.521 |
|---|
| InChIKey | MWPMMSVYHPAOIO-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)NCCc1ccc(C(C)=O)cc1 |
|---|
Synonyms
| 4'-(2-Acetamidoethyl)-acetophenone |
| N-(4-acetyl-phenethyl)-acetamide |
| N-(4-Acetyl-phenaethyl)-acetamid |
| 1-[4-(2-Acetamino-aethyl)-phenyl]-aethanon-(1) |
