Introduction：Basic information about CAS 5018-87-1|2-(1-Naphthoyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(1-Naphthoyl)benzoic acid |
|---|
| CAS Number | 5018-87-1 | Molecular Weight | 276.28600 |
|---|
| Density | 1.289g/cm3 | Boiling Point | 525.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 285.9ºC |
|---|
Names
| Name | 2-(naphthalene-1-carbonyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.289g/cm3 |
|---|
| Boiling Point | 525.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H12O3 |
|---|
| Molecular Weight | 276.28600 |
|---|
| Flash Point | 285.9ºC |
|---|
| Exact Mass | 276.07900 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 3.76900 |
|---|
| Index of Refraction | 1.678 |
|---|
| InChIKey | OXCYAVHGYGKEJY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccccc1C(=O)c1cccc2ccccc12 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-(naphthalene-1-carbonyl)-benzoic acid |
| Benzoic acid,2-(1-naphthalenylcarbonyl) |
| 2-(1-naphthalenylcarbonyl)-benzoic acid |
| 2-(naphthalen-1-ylcarbonyl)benzoic acid |
| Benzoic acid,o-1-naphthoyl |
| 2-[1]naphthoyl-benzoic acid |
| 2-[1]Naphthoyl-benzoesaeure |
