Introduction：Basic information about CAS 66387-70-0|4-bromo-9-phenyl-8-oxa-10-azabicyclo[4.4.0]deca-2,4,9,11-tetraen-7-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-bromo-9-phenyl-8-oxa-10-azabicyclo[4.4.0]deca-2,4,9,11-tetraen-7-one |
|---|
| CAS Number | 66387-70-0 | Molecular Weight | 302.12300 |
|---|
| Density | 1.56g/cm3 | Boiling Point | 405.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H8BrNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 199.3ºC |
|---|
Names
| Name | 6-bromo-2-phenyl-3,1-benzoxazin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.56g/cm3 |
|---|
| Boiling Point | 405.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H8BrNO2 |
|---|
| Molecular Weight | 302.12300 |
|---|
| Flash Point | 199.3ºC |
|---|
| Exact Mass | 300.97400 |
|---|
| PSA | 43.10000 |
|---|
| LogP | 3.61750 |
|---|
| Index of Refraction | 1.669 |
|---|
| InChIKey | MNZCLMDWYBZFGY-UHFFFAOYSA-N |
|---|
| SMILES | O=c1oc(-c2ccccc2)nc2ccc(Br)cc12 |
|---|
Synonyms
| 2-phenyl-6-bromo-4-oxo-3,1-benzoxazine |
| 6-bromo-2-phenyl-3,1-benzoxazin-4(3H)-one |
| 2-phenyl-6-bromo-3,1-benzoxazin-4-one |
| 6-bromo-2-phenyl-4H-benzo[d][1,3]oxazin-4-one |
| 2-phenyl-6-bromo-3,1,4-benzoxazinone |
| 6-bromo-2-phenyl-4H-3,1-benzoxazin-4-one |
| 6-bromo-2-phenyl-4H-benz[3,1]oxazin-4-one |
