Introduction：Basic information about CAS 6220-77-5|3-Pyridinecarbonitrile,2-chloro-4,6-dimethyl-5-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Pyridinecarbonitrile,2-chloro-4,6-dimethyl-5-nitro- |
|---|
| CAS Number | 6220-77-5 | Molecular Weight | 211.60500 |
|---|
| Density | 1.42g/cm3 | Boiling Point | 340.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.6ºC |
|---|
Names
| Name | 2-chloro-4,6-dimethyl-5-nitropyridine-3-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.42g/cm3 |
|---|
| Boiling Point | 340.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6ClN3O2 |
|---|
| Molecular Weight | 211.60500 |
|---|
| Flash Point | 159.6ºC |
|---|
| Exact Mass | 211.01500 |
|---|
| PSA | 82.50000 |
|---|
| LogP | 2.65488 |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | JVWPZCCMTFKYHN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(Cl)c(C#N)c(C)c1[N+](=O)[O-] |
|---|
Synonyms
| 2-Chloro-4,6-dimethyl-5-nitro-nicotinonitrile |
| 2-chloro-5-nitro-3-cyano-4,6-dimethylpyridine |
| 2,4-dimethyl-3-nitro-5-cyano-6-chloropyridine |
| 2-chloro-3-cyano-4,6-dimethyl-5-nitropyridine |
| 2-Chlor-3-cyan-4,6-dimethyl-5-nitro-pyridin |
| BB_SC-0330 |
| 2-Chlor-4,6-dimethyl-5-nitro-nicotinonitril |
| 6-Chlor-5-cyano-2,4-dimethyl-3-nitro-pyridin |
