Introduction:Basic information about CAS 1033288-92-4|Pre-schisanartanin B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pre-schisanartanin B |
|---|
| CAS Number | 1033288-92-4 | Molecular Weight | 590.66 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 793.3±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C31H42O11 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 256.6±26.4 °C |
|---|
Names
| Name | Prenylbromzink |
|---|
| Synonym | More Synonyms |
|---|
Pre-schisanartanin B BiologicalActivity
| Description | Preschisanartanin B (compound 9) is a preschisanartane-type nortriterpenoid. Preschisanartanin B can be isolated from the Schisandra arisanensis[1]. |
|---|
| Related Catalog | Research Areas >>OthersSignaling Pathways >>Others >>Others |
|---|
| References | [1]. Yuan-Bin Cheng, et al. Nortriterpene lactones from the fruits of Schisandra arisanensis. J Nat Prod. 2010, 73, 7. |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 793.3±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C31H42O11 |
|---|
| Molecular Weight | 590.66 |
|---|
| Flash Point | 256.6±26.4 °C |
|---|
| Exact Mass | 590.272705 |
|---|
| PSA | 154.89000 |
|---|
| LogP | 0.68 |
|---|
| Vapour Pressure | 0.0±6.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | XVOAOTAZULSEBL-BJQUNPTCSA-N |
|---|
| SMILES | CC(=O)OC(C1CC(C)C(=O)O1)C(C)C1C2C3(O)OC4(CCC12C)C(CCC1C(C)(C)OC2CC(=O)OC21C4O)C3=O |
|---|
Safety Information
Synonyms
| 3-Methyl-2-butenylzinc bromide |
| (1S,2S)-2-[(1R,2S,3S,7R,10S,13R,15S,16S,17R,18R)-2,15-Dihydroxy-9,9,18-trimethyl-5,14-dioxo-4,8,21-trioxahexacyclo[13.5.1.0.0.0.0]henicos-17-yl]-1-[(2S)-4-methyl-5-oxotetrahydr o-2-furanyl]propyl acetate |
| pre-schinsanartanin B |
| 13H-9,12a-Epoxy-2H-cyclopropa[5',6']cycloocta[1',2':5,6]cyclohepta[1,2-c]furo[3,2-b]furan-2,8(5H)-dione, 10-[(1S,2S)-2-(acetyloxy)-1-methyl-2-[(2S)-tetrahydro-4-methyl-5-oxo-2-furanyl]ethyl]dodecahydro-9,13-dihydroxy-5,5,10a-trimethyl-, (3aR,5aS,7aR,9S,9aS,10R,10aR,12aR,13S,13aS)- |
| Me2CCHCH2ZnBr |
| prenylzinc bromide |
| pre-schisanartanin B |