Introduction：Basic information about CAS 6607-41-6|Phenolphthalein anilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenolphthalein anilide |
|---|
| CAS Number | 6607-41-6 | Molecular Weight | 393.43400 |
|---|
| Density | 1.338g/cm3 | Boiling Point | 610.2ºC at 760 mmHg |
|---|
| Molecular Formula | C26H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 322.8ºC |
|---|
Names
| Name | 3,3-Bis(4-hydroxyphenyl)-2-phenyl-1-isoindolinone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.338g/cm3 |
|---|
| Boiling Point | 610.2ºC at 760 mmHg |
|---|
| Molecular Formula | C26H19NO3 |
|---|
| Molecular Weight | 393.43400 |
|---|
| Flash Point | 322.8ºC |
|---|
| Exact Mass | 393.13600 |
|---|
| PSA | 60.77000 |
|---|
| LogP | 5.11510 |
|---|
| Index of Refraction | 1.707 |
|---|
| InChIKey | YBLBHSSRHHJKEK-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(c2ccc(O)cc2)(c2ccc(O)cc2)N1c1ccccc1 |
|---|
Synonyms
| 2-Phenyl-4H-3,1-benzoxazin-4-one |
| 2-phenyl-1,2-dihydro-4H-3,1-benzoxazin-4-one |
| 2-phenylbenzoxazinone |
| 2-phenyl-3,3-bis(4-hydroxyphenyl)phthalimidine |
| Linurotox |
| para,para-PPPBP |
| 2-Phenyl-3,1-benzoxazinone-(4) |
| Linarotox |
| 3,3-bis-(4-hydroxy-phenyl)-2-phenyl-isoindolin-1-one |
| Phenolphthalein-anilid |
| 4H-3,1-BENZOXAZIN-4-ONE,2-PHENYL |
| 2-phenyl-4-H-benzo[d][1,3]oxazin-4-one |
| 2-phenyl-3,3-bis(p-phenol)phthalimidine |
| 2-phenyl-4H-benzo[d][1,3]oxazine-4-one |
| Bentranil |
| H-170 |
| Phenolphthalein anilide |
