Introduction：Basic information about CAS 94110-86-8|ethyl 8-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 8-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylate |
|---|
| CAS Number | 94110-86-8 | Molecular Weight | 262.21800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H10N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Ethyl 8-nitro-4-oxo-3,4-dihydro-3-quinolinecarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H10N2O5 |
|---|
| Molecular Weight | 262.21800 |
|---|
| Exact Mass | 262.05900 |
|---|
| PSA | 101.55000 |
|---|
| LogP | 1.63150 |
|---|
| InChIKey | BBZKFRDLBJHFMD-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C1C=Nc2c(cccc2[N+](=O)[O-])C1=O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 8-nitro-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid ethyl ester |
| ethyl 8-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylate |
| 2-Anilino-4-methyl-8-nitroquinoline |
| (4-methyl-8-nitro-quinolin-2-yl)-phenyl-amine |
| 8-Nitro-2-phenylamino-lepidin |
| 1,4-dihydro-8-nitro-4-oxo-3-quinolinecarboxylic acid ethyl ester |
| Lepidine,2-anilino-8-nitro-(7CI,8CI) |
| N-(4-Methyl-8-nitro-2-quinolinyl)-N-phenylamine |
| 3-ethoxycarbonyl-1,4-dihydro-8-nitro-4-oxoquinoline |
| 8-Nitro-4-methyl-2-anilinochinolin |
| 2-Quinolinamine,4-methyl-8-nitro-N-phenyl |
