Introduction:Basic information about CAS 524955-09-7|3-Chloro-4-[(pyridin-2-yl)methyloxy]aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Chloro-4-[(pyridin-2-yl)methyloxy]aniline |
|---|
| CAS Number | 524955-09-7 | Molecular Weight | 234.682 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 402.5±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H11ClN2O | Melting Point | 93 °C |
|---|
| MSDS | / | Flash Point | 197.2±25.9 °C |
|---|
Names
| Name | 3-chloro-4-(pyridin-2-ylmethoxy)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 402.5±35.0 °C at 760 mmHg |
|---|
| Melting Point | 93 °C |
|---|
| Molecular Formula | C12H11ClN2O |
|---|
| Molecular Weight | 234.682 |
|---|
| Flash Point | 197.2±25.9 °C |
|---|
| Exact Mass | 234.055984 |
|---|
| PSA | 48.14000 |
|---|
| LogP | 1.74 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | XCAPJQSICQSUJP-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(OCc2ccccn2)c(Cl)c1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-CHLORO-4-((PYRIDIN-2-YL)METHOXY)ANILINE |
| 3-chloro-4-(2-pyridinylMethoxy)-BenzenaMine |
| Benzenamine, 3-chloro-4-(2-pyridinylmethoxy)- |
| 3-chloro-4-(pyridin-2-ylmethoxy)aniline |
| 3-chloro-4-(pyridine-2-ylmethoxy)aniline |
| 3-Chloro-4-(2-pyridinylmethoxy)aniline |
| 4-pyridin-2-yl-methoxy-3-chloroaniline |
| Benzenamine,3-chloro-4-(2-pyridinylmethoxy) |
| 3-chloro-4-(pyridin-2-yl-methoxy)benzenamine |
| 3-Chloro-4-[(pyridin-2-yl)methyloxy]aniline |