Introduction：Basic information about CAS 1006062-28-7|5-[2-[4-[[2-butyl-4-chloro-5-(trityloxymethyl)imidazol-1-yl]methyl]phenyl]phenyl]-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-[2-[4-[[2-butyl-4-chloro-5-(trityloxymethyl)imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole |
|---|
| CAS Number | 1006062-28-7 | Molecular Weight | 665.225 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 814.6±75.0 °C at 760 mmHg |
|---|
| Molecular Formula | C41H37ClN6O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 446.5±37.1 °C |
|---|
Names
| Name | 5-[2-[4-[[2-butyl-4-chloro-5-(trityloxymethyl)imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 814.6±75.0 °C at 760 mmHg |
|---|
| Molecular Formula | C41H37ClN6O |
|---|
| Molecular Weight | 665.225 |
|---|
| Flash Point | 446.5±37.1 °C |
|---|
| Exact Mass | 664.271729 |
|---|
| PSA | 81.51000 |
|---|
| LogP | 10.44 |
|---|
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.650 |
|---|
| InChIKey | RIUQREUAFRCKLE-UHFFFAOYSA-N |
|---|
| SMILES | CCCCc1nc(Cl)c(COC(c2ccccc2)(c2ccccc2)c2ccccc2)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
|---|
Synonyms
| O-Trityl Losartan |
| 5-[4'-({2-Butyl-4-chloro-5-[(trityloxy)methyl]-1H-imidazol-1-yl}methyl)-2-biphenylyl]-1H-tetrazole |
| Losartan Trityl Ether |
| I971 |
| 1H-Tetrazole, 5-[4'-[[2-butyl-4-chloro-5-[(triphenylmethoxy)methyl]-1H-imidazol-1-yl]methyl][1,1'-biphenyl]-2-yl]- |
| Losartan Impurity D |
