Introduction：Basic information about CAS 668261-27-6|tert-butyl 2-amino-5-iodobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl 2-amino-5-iodobenzoate |
|---|
| CAS Number | 668261-27-6 | Molecular Weight | 319.13900 |
|---|
| Density | 1.586g/cm3 | Boiling Point | 360.343ºC at 760 mmHg |
|---|
| Molecular Formula | C11H14INO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 171.73ºC |
|---|
Names
| Name | tert-butyl 2-amino-5-iodobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.586g/cm3 |
|---|
| Boiling Point | 360.343ºC at 760 mmHg |
|---|
| Molecular Formula | C11H14INO2 |
|---|
| Molecular Weight | 319.13900 |
|---|
| Flash Point | 171.73ºC |
|---|
| Exact Mass | 319.00700 |
|---|
| PSA | 52.32000 |
|---|
| LogP | 3.40990 |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | QNUOGGUIWUBLJN-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)c1cc(I)ccc1N |
|---|
Synonyms
| t-butyl 2-amino-5-iodobenzoate |
| tert-butyl 2-azanyl-5-iodanyl-benzoate |
| tert-butyl 2-amino-5-iodo-benzoate |
