Introduction：Basic information about CAS 23481-33-6|(5E)-6-Oxo-5-(phenylhydrazono)-5,6-dihydro-2-naphthalenesulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (5E)-6-Oxo-5-(phenylhydrazono)-5,6-dihydro-2-naphthalenesulfonic acid |
|---|
| CAS Number | 23481-33-6 | Molecular Weight | 328.34200 |
|---|
| Density | 1.43g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C16H12N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (5E)-6-Oxo-5-(phenylhydrazono)-5,6-dihydro-2-naphthalenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Molecular Formula | C16H12N2O4S |
|---|
| Molecular Weight | 328.34200 |
|---|
| Exact Mass | 328.05200 |
|---|
| PSA | 104.21000 |
|---|
| LogP | 3.49920 |
|---|
| Index of Refraction | 1.676 |
|---|
| InChIKey | GTRGJJDVSJFNTE-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1ccc2c(N=Nc3ccccc3)c(O)ccc2c1 |
|---|
Synonyms
| 1-Phenylazo-naphthol-(2)-sulfonsaeure-(6) |
| 5-Phenylazo-6-hydroxy-chrysen |
| 1-Benzolazo-naphthol-(2)-sulfonsaeure-(6) |
| 1-phenylazo-2-naphthol-6-sulfonic acid |
| 6-hydroxy-5-phenylazo-naphthalene-2-sulfonic acid |
| 6-Hydroxy-5-phenylazo-naphthalin-2-sulfonsaeure |
| 6-Hydroxy-5-phenylazochrysen |
| 6-Chrysenol,5-(phenylazo) |
| 1-Phenylazo-schaeffersaeure |
| Phenylazo-Schaeffer-Saeure |
