Introduction:Basic information about CAS 290300-93-5|ethyl 2-(4-methylpiperazin-1-yl)pyridine-4-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-(4-methylpiperazin-1-yl)pyridine-4-carboxylate |
|---|
| CAS Number | 290300-93-5 | Molecular Weight | 249.30900 |
|---|
| Density | 1.131g/cm3 | Boiling Point | 391.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H19N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.3ºC |
|---|
Names
| Name | ethyl 2-(4-methylpiperazin-1-yl)pyridine-4-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.131g/cm3 |
|---|
| Boiling Point | 391.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H19N3O2 |
|---|
| Molecular Weight | 249.30900 |
|---|
| Flash Point | 190.3ºC |
|---|
| Exact Mass | 249.14800 |
|---|
| PSA | 45.67000 |
|---|
| LogP | 1.01300 |
|---|
| Vapour Pressure | 2.53E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.54 |
|---|
| InChIKey | HGMRXLZVAAVHGD-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccnc(N2CCN(C)CC2)c1 |
|---|