Introduction：Basic information about CAS 66211-92-5|Detorubicin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Detorubicin |
|---|
| CAS Number | 66211-92-5 | Molecular Weight | 673.66100 |
|---|
| Density | 1.49g/cm3 | Boiling Point | 860.2ºC at 760 mmHg |
|---|
| Molecular Formula | C33H39NO14 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 474.1ºC |
|---|
Names
| Name | 2-{(2S,4S)-4-[(3-Amino-2,3,6-trideoxy-α-L-lyxo-hexopyranosyl)oxy] -2,5,12-trihydroxy-7-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydro-2- tetracenyl}-2-oxoethyl diethoxyacetate |
|---|
Chemical & Physical Properties
| Density | 1.49g/cm3 |
|---|
| Boiling Point | 860.2ºC at 760 mmHg |
|---|
| Molecular Formula | C33H39NO14 |
|---|
| Molecular Weight | 673.66100 |
|---|
| Flash Point | 474.1ºC |
|---|
| Exact Mass | 673.23700 |
|---|
| PSA | 230.60000 |
|---|
| LogP | 1.65160 |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | XZSRRNFBEIOBDA-CFNBKWCHSA-N |
|---|
| SMILES | CCOC(OCC)C(=O)OCC(=O)C1(O)Cc2c(O)c3c(c(O)c2C(OC2CC(N)C(O)C(C)O2)C1)C(=O)c1c(OC)cccc1C3=O |
|---|
