Introduction：Basic information about CAS 32351-70-5|dimethylammonium 2-(4-chloro-2-methylphenoxy)propionate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimethylammonium 2-(4-chloro-2-methylphenoxy)propionate |
|---|
| CAS Number | 32351-70-5 | Molecular Weight | 259.72900 |
|---|
| Density | / | Boiling Point | 322.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H18ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 148.8ºC |
|---|
Names
| Name | mecoprop-dimethylammonium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 322.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H18ClNO3 |
|---|
| Molecular Weight | 259.72900 |
|---|
| Flash Point | 148.8ºC |
|---|
| Exact Mass | 259.09800 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 2.72680 |
|---|
| InChIKey | ROGDGDPDLIVQFZ-UHFFFAOYSA-N |
|---|
| SMILES | CNC.Cc1cc(Cl)ccc1OC(C)C(=O)O |
|---|
Synonyms
| dimethylammonium (RS)-2-(4-chloro-o-tolyloxy)propionate |
| 2-(4-chloro-2-methylphenoxy)propanoic acid compound with N-methylmethanamine (1:1) |
| (RS)-2-(4-chloro-o-tolyloxy)propionic acid - dimethylamine (1:1) |
| 2-(4-chloro-2-methyl-phenoxy)propanoic acid, N-methylmethanamine |
| rac-(2R)-2-(4-chloro-2-methylphenoxy)propanoic acid—N-methylmethanamine |
