Introduction：Basic information about CAS 606-90-6|piprinhydrinate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | piprinhydrinate |
|---|
| CAS Number | 606-90-6 | Molecular Weight | 496.00100 |
|---|
| Density | / | Boiling Point | 378.7ºC at 760 mmHg |
|---|
| Molecular Formula | C26H30ClN5O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 111.6ºC |
|---|
Names
| Name | 4-benzhydryloxy-1-methylpiperidine,8-chloro-1,3-dimethyl-7H-purine-2,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 378.7ºC at 760 mmHg |
|---|
| Molecular Formula | C26H30ClN5O3 |
|---|
| Molecular Weight | 496.00100 |
|---|
| Flash Point | 111.6ºC |
|---|
| Exact Mass | 495.20400 |
|---|
| PSA | 85.15000 |
|---|
| LogP | 3.43840 |
|---|
| InChIKey | JSNIFGPPGAINSG-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCC(OC(c2ccccc2)c2ccccc2)CC1.Cn1c(=O)c2[nH]c(Cl)nc2n(C)c1=O |
|---|
Synonyms
| Kolton |
| 8-chloro-1,3-dimethyl-3,7-dihydro-purine-2,6-dione,compound with 4-benzhydryloxy-1-methyl-piperidine |
| Piprinhydrinat |
| Diphenylpyralin-8-chlor-theophyllinat [German] |
| Piprinhydrinatum [INN-Latin] |
| 8-Chlor-1,3-dimethyl-3,7-dihydro-purin-2,6-dion,Verbindung mit 4-Benzhydryloxy-1-methyl-piperidin |
| Piprinhidrinato [INN-Spanish] |
| diphenylpyraline teoclate |
| Piprinhydrinate |
| Theophylline,8-chloro-,compd. with 4-(diphenylmethoxy)-1-methylpiperidine (1:1) |
| EINECS 210-128-0 |
| 4-(Diphenylmethoxy)-1-methylpiperidine 8-chlorotheophylline |
