Introduction：Basic information about CAS 468-61-1|oxeladin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | oxeladin |
|---|
| CAS Number | 468-61-1 | Molecular Weight | 335.48100 |
|---|
| Density | 0.991g/cm3 | Boiling Point | 421.2ºC at 760mmHg |
|---|
| Molecular Formula | C20H33NO3 | Melting Point | 25°C |
|---|
| MSDS | / | Flash Point | 208.5ºC |
|---|
Names
| Name | 2-[2-(Diethylamino)ethoxy]ethyl 2-ethyl-2-phenylbutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.991g/cm3 |
|---|
| Boiling Point | 421.2ºC at 760mmHg |
|---|
| Melting Point | 25°C |
|---|
| Molecular Formula | C20H33NO3 |
|---|
| Molecular Weight | 335.48100 |
|---|
| Flash Point | 208.5ºC |
|---|
| Exact Mass | 335.24600 |
|---|
| PSA | 38.77000 |
|---|
| LogP | 3.64600 |
|---|
| Vapour Pressure | 2.66E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.492 |
|---|
| InChIKey | IQADUMSPOQKAAO-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCOCCOC(=O)C(CC)(CC)c1ccccc1 |
|---|
Synonyms
| 2-Aethyl-2-phenyl-buttersaeure-[2-(2-diaethylamino-aethoxy)-aethylester] |
| 2-(2-Diethylaminoethoxy)ethyl 2-ethyl-2-phenylbutyrate |
| 2-ethyl-2-phenyl-butyric acid-[2-(2-diethylamino-ethoxy)-ethyl ester] |
| Oxeladinum |
| Oxeladinum [INN-Latin] |
| Oxeladine |
| EINECS 207-412-1 |
| Oxeladin |
| Oxeladine [INN-French] |
| Oxeladina |
| Oxeladina [INN-Spanish] |
