Introduction：Basic information about CAS 75949-61-0|Pafenolol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pafenolol |
|---|
| CAS Number | 75949-61-0 | Molecular Weight | 337.45700 |
|---|
| Density | 1.064g/cm3 | Boiling Point | 551.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H31N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 287.2ºC |
|---|
Names
| Name | 1-(2-{4-[2-Hydroxy-3-(isopropylamino)propoxy]phenyl}ethyl)-3-isop ropylure |
|---|
Chemical & Physical Properties
| Density | 1.064g/cm3 |
|---|
| Boiling Point | 551.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H31N3O3 |
|---|
| Molecular Weight | 337.45700 |
|---|
| Flash Point | 287.2ºC |
|---|
| Exact Mass | 337.23700 |
|---|
| PSA | 86.11000 |
|---|
| LogP | 2.66060 |
|---|
| Index of Refraction | 1.52 |
|---|
| InChIKey | PKWZWSXSCKVUJB-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)NCC(O)COc1ccc(CCNC(=O)NC(C)C)cc1 |
|---|
