Introduction：Basic information about CAS 77599-17-8|Panomifene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Panomifene |
|---|
| CAS Number | 77599-17-8 | Molecular Weight | 427.45900 |
|---|
| Density | 1.203g/cm3 | Boiling Point | 550.7ºC at 760 mmHg |
|---|
| Molecular Formula | C25H24F3NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 286.9ºC |
|---|
Names
| Name | 2-[2-[4-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]phenoxy]ethylamino]ethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.203g/cm3 |
|---|
| Boiling Point | 550.7ºC at 760 mmHg |
|---|
| Molecular Formula | C25H24F3NO2 |
|---|
| Molecular Weight | 427.45900 |
|---|
| Flash Point | 286.9ºC |
|---|
| Exact Mass | 427.17600 |
|---|
| PSA | 41.49000 |
|---|
| LogP | 5.55960 |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | MHXVDXXARZCVRK-WCWDXBQESA-N |
|---|
| SMILES | OCCNCCOc1ccc(C(=C(c2ccccc2)C(F)(F)F)c2ccccc2)cc1 |
|---|
Synonyms
| Panomifeno [Spanish] |
| (E)-1,2-Diphenyl-1-(4-((2-hydroxyethylamino)ethoxy)phenyl)-3,3,3-trifluoro-1-propene |
| Panomifenum [Latin] |
| (E)-2-((2-(4-(3,3,3-Trifluoro-1,2-diphenyl-1-propenyl)phenoxy)ethyl)amino)ethanol |
| Ethanol,2-((2-(4-(3,3,3-trifluoro-1,2-diphenyl-1-propenyl)phenoxy)ethyl)amino)-,(E) |
| (E)-2-((2-(p-(3,3,3-Trifluoro-1,2-diphenylpropenyl)phenoxy)ethyl)amino)ethanol |
| Panomifeno |
| EGIS-5650 |
| Panomifene |
