Introduction：Basic information about CAS 7298-65-9|FLuorescein dibutyrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | FLuorescein dibutyrate |
|---|
| CAS Number | 7298-65-9 | Molecular Weight | 472.48600 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 634.4ºC at 760 mmHg |
|---|
| Molecular Formula | C28H24O7 | Melting Point | 118-119ºC(lit.) |
|---|
| MSDS | / | Flash Point | 271.6ºC |
|---|
Names
| Name | (6'-butanoyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) butanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 634.4ºC at 760 mmHg |
|---|
| Melting Point | 118-119ºC(lit.) |
|---|
| Molecular Formula | C28H24O7 |
|---|
| Molecular Weight | 472.48600 |
|---|
| Flash Point | 271.6ºC |
|---|
| Exact Mass | 472.15200 |
|---|
| PSA | 88.13000 |
|---|
| LogP | 5.66560 |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | CGMHIZMGYHYHML-UHFFFAOYSA-N |
|---|
| SMILES | CCCC(=O)Oc1ccc2c(c1)Oc1cc(OC(=O)CCC)ccc1C21OC(=O)c2ccccc21 |
|---|
| Storage condition | -20°C |
|---|
Safety Information
Synonyms
| Dibutyryl-fluorescein |
| Fluorescein dibutyrate |
| fluorescien dibutyrate |
| Fluorescein-dibutyrat |
| fluorescein diabutyrate |
| 3-oxo-3h-spiro[2-benzofuran-1,9'-xanthene]-3',6'-diyl dibutanoate |
| MFCD00037842 |
