Introduction:Basic information about CAS 1026353-20-7|4'-[(1,7'-Dimethyl-2'-propyl[2,5'-bi-1H-benzimidazol]-1'-yl)met, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-[(1,7'-Dimethyl-2'-propyl[2,5'-bi-1H-benzimidazol]-1'-yl)methyl][1,1'-biphenyl]-2-carboxylic Acid |
|---|
| CAS Number | 1026353-20-7 | Molecular Weight | 514.61700 |
|---|
| Density | 1.24±0.1 g/cm3 (20 ºC 760 Torr) | Boiling Point | / |
|---|
| Molecular Formula | C33H30N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-[4-[[7-methyl-5-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24±0.1 g/cm3 (20 ºC 760 Torr) |
|---|
| Molecular Formula | C33H30N4O2 |
|---|
| Molecular Weight | 514.61700 |
|---|
| Exact Mass | 514.23700 |
|---|
| PSA | 72.94000 |
|---|
| LogP | 7.26440 |
|---|
| InChIKey | COYNILPBALLLCR-UHFFFAOYSA-N |
|---|
| SMILES | CCCc1nc2cc(-c3nc4ccccc4n3C)cc(C)c2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
|---|
| Water Solubility | Insuluble (5.7E-5 g/L) (25 ºC) |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| UNII-3178N39Y2I |
| Telmisartan related compound B RS [USP] |
| Telmisartan related compound B [USP] |
| 4'-[(1,7'-Dimethyl-2'-propyl[2,5'-bi-1H-benzimidazol]-1'-yl)methyl][1,1'-biphenyl]-2-carboxylic Acid |
| (1,1'-Biphenyl)-2-carboxylic acid,4'-((1,7'-dimethyl-2'-propyl(2,5'-bi-1H-benzimidazol)-1'-yl)methyl) |
| Telmisartan related compound B |
| Telmisartan specified impurity B [EP] |
| BIP036 |
| Telmisartan Impurity 1 |