Introduction：Basic information about CAS 10265-69-7|sodium,2-anilinoacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sodium,2-anilinoacetate |
|---|
| CAS Number | 10265-69-7 | Molecular Weight | 173.14400 |
|---|
| Density | 1.259g/cm3 | Boiling Point | 359ºC at 760mmHg |
|---|
| Molecular Formula | C8H8NNaO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 170.9ºC |
|---|
Names
| Name | sodium,2-anilinoacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.259g/cm3 |
|---|
| Boiling Point | 359ºC at 760mmHg |
|---|
| Molecular Formula | C8H8NNaO2 |
|---|
| Molecular Weight | 173.14400 |
|---|
| Flash Point | 170.9ºC |
|---|
| Exact Mass | 173.04500 |
|---|
| PSA | 52.16000 |
|---|
| Vapour Pressure | 8.86E-06mmHg at 25°C |
|---|
| InChIKey | YEMGQZDWLLBIEY-UHFFFAOYSA-M |
|---|
| SMILES | O=C([O-])CNc1ccccc1.[Na+] |
|---|
Safety Information
Customs
| HS Code | 2922499990 |
|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Glycine,N-phenyl-,monosodium salt |
| sodium phenylglycinate |
| sodium salt of D(-)-phenylglycine |
| sodium anilinoacetate |
| N-phenyl-glycine,sodium salt |
| EINECS 233-605-5 |
| Glycine,N-phenyl-,sodium salt (1:1) |
| N-Phenylglycime sodium salt |
| D-phenylglycine sodium salt |
| sodium N-phenyl-glycinate |
| sodium (phenylamino)acetate |
