Introduction:Basic information about CAS 103980-45-6|Metostilenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Metostilenol |
|---|
| CAS Number | 103980-45-6 | Molecular Weight | 263.33200 |
|---|
| Density | 1.128g/cm3 | Boiling Point | 438.2ºC at 760mmHg |
|---|
| Molecular Formula | C15H21NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 218.8ºC |
|---|
Names
| Name | (E)-4-(4-methoxyphenyl)-1-morpholin-4-ylbut-3-en-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.128g/cm3 |
|---|
| Boiling Point | 438.2ºC at 760mmHg |
|---|
| Molecular Formula | C15H21NO3 |
|---|
| Molecular Weight | 263.33200 |
|---|
| Flash Point | 218.8ºC |
|---|
| Exact Mass | 263.15200 |
|---|
| PSA | 41.93000 |
|---|
| LogP | 1.33940 |
|---|
| Vapour Pressure | 1.87E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | JIQSYJYZZDCLEF-GORDUTHDSA-N |
|---|
| SMILES | COc1ccc(C=CC(O)CN2CCOCC2)cc1 |
|---|
Synonyms
| UNII-737T1YVX89 |
| Metostilenol |