Introduction：Basic information about CAS 2217-81-4|Selenium,dichlorodiphenyl-, (T-4)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Selenium,dichlorodiphenyl-, (T-4)- |
|---|
| CAS Number | 2217-81-4 | Molecular Weight | 304.07400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H10Cl2Se | Melting Point | 178-183ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | [dichloro(phenyl)-λ4-selanyl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 178-183ºC |
|---|
| Molecular Formula | C12H10Cl2Se |
|---|
| Molecular Weight | 304.07400 |
|---|
| Exact Mass | 303.93200 |
|---|
| LogP | 2.72060 |
|---|
| InChIKey | JNHRULRRPDYSKM-UHFFFAOYSA-N |
|---|
| SMILES | Cl[Se](Cl)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | N: Dangerous for the environment;T: Toxic; |
|---|
| Risk Phrases | R50/53 |
|---|
| Safety Phrases | 61-60-45-28A-20/21 |
|---|
| RIDADR | UN 3283 |
|---|
Synonyms
| diphenyldichloroselenurane |
| Diphenylselenium dichloride |
| diphenyl selenide dichloride |
| Diphenylselendichlorid |
| Dichlorodiphenylselenium |
| MFCD00013599 |
| Dichlor-diphenyl-selen |
| Selenium,dichlorodiphenyl |
