Introduction：Basic information about CAS 72906-16-2|N-[2-[(2-chloro-4,6-dinitrophenyl)azo]-5-(diethylamino)phenyl]benzamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-[(2-chloro-4,6-dinitrophenyl)azo]-5-(diethylamino)phenyl]benzamide |
|---|
| CAS Number | 72906-16-2 | Molecular Weight | 496.90300 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 627.1ºC at 760 mmHg |
|---|
| Molecular Formula | C23H21ClN6O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 333ºC |
|---|
Names
| Name | N-[2-[(2-chloro-4,6-dinitrophenyl)diazenyl]-5-(diethylamino)phenyl]benzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 627.1ºC at 760 mmHg |
|---|
| Molecular Formula | C23H21ClN6O5 |
|---|
| Molecular Weight | 496.90300 |
|---|
| Flash Point | 333ºC |
|---|
| Exact Mass | 496.12600 |
|---|
| PSA | 152.19000 |
|---|
| LogP | 8.10070 |
|---|
| Index of Refraction | 1.65 |
|---|
| InChIKey | XLQOBJJPASQKHH-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)c1ccc(N=Nc2c(Cl)cc([N+](=O)[O-])cc2[N+](=O)[O-])c(NC(=O)c2ccccc2)c1 |
|---|
Synonyms
| Benzamide,N-[2-[(2-chloro-4,6-dinitrophenyl)azo]-5-(diethylamino)phenyl]-(9CI) |
| Benzamide,N-(2-(2-(2-chloro-4,6-dinitrophenyl)diazenyl)-5-(diethylamino)phenyl) |
| N-(2-((2-Chloro-4,6-dinitrophenyl)azo)-5-(diethylamino)phenyl)benzamide |
| Benzamide,N-(2-((2-chloro-4,6-dinitrophenyl)azo)-5-(diethylamino)phenyl) |
| EINECS 276-991-0 |
