Introduction:Basic information about CAS 23128-74-7|antioxidant 1098, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | antioxidant 1098 |
|---|
| CAS Number | 23128-74-7 | Molecular Weight | 636.94700 |
|---|
| Density | 1.021g/cm3 | Boiling Point | 740.1ºC at 760mmHg |
|---|
| Molecular Formula | C40H64N2O4 | Melting Point | 156-161ºC |
|---|
| MSDS | / | Flash Point | 401.4ºC |
|---|
Names
| Name | N,N'-bis[β-(3,5-di-tert-butyl-4-hydroxyphenyl)propionyl]hexamethylenediamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.021g/cm3 |
|---|
| Boiling Point | 740.1ºC at 760mmHg |
|---|
| Melting Point | 156-161ºC |
|---|
| Molecular Formula | C40H64N2O4 |
|---|
| Molecular Weight | 636.94700 |
|---|
| Flash Point | 401.4ºC |
|---|
| Exact Mass | 636.48700 |
|---|
| PSA | 98.66000 |
|---|
| LogP | 9.42780 |
|---|
| Vapour Pressure | 1.19E-22mmHg at 25°C |
|---|
| Index of Refraction | 1.525 |
|---|
| InChIKey | OKOBUGCCXMIKDM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(CCC(=O)NCCCCCCNC(=O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| EINECS 245-442-7 |
| N,N'-(Hexane-1,6-diyl)bis(3-(3,5-di-tert-butyl-4-hydroxyphenyl)propanamide) |
| Antioxidant 1098 |
| Irganox 1098 |
| TTAD |
| Iraganox 1098 |
| Thanox1098 |
| MFCD00134697 |
| At 1098 |
| ethyl 3,5-di-tert-butyl-4-hydroxybenzylphosphonic acid.Ca |