Introduction:Basic information about CAS 22385-77-9|1-Bromo-3,5-di-tert-butybenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Bromo-3,5-di-tert-butybenzene |
|---|
| CAS Number | 22385-77-9 | Molecular Weight | 269.220 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 251.0±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H21Br | Melting Point | 62-66 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 98.9±13.1 °C |
|---|
Names
| Name | 1-bromo-3,5-ditert-butylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 251.0±9.0 °C at 760 mmHg |
|---|
| Melting Point | 62-66 °C(lit.) |
|---|
| Molecular Formula | C14H21Br |
|---|
| Molecular Weight | 269.220 |
|---|
| Flash Point | 98.9±13.1 °C |
|---|
| Exact Mass | 268.082642 |
|---|
| LogP | 6.37 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.504 |
|---|
| InChIKey | BUOWTUULDKULFI-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(Br)cc(C(C)(C)C)c1 |
|---|
| Storage condition | Room temperature. |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2903999090 |
|---|
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-bromo-3,5-di-tert-butylbenzene |
| 3,5-Di-Tert-Butylbromobenzene |
| 1-Bromo-3,5-di-tert-butybenzene |
| 1X1&1&R CE EX1&1&1 |
| 3,5-di-t-butylbromobenzene |
| bromo-3,5-di-t-butylbenzene |
| 1-Bromo-3,5-bis(2-methyl-2-propanyl)benzene |
| Benzene, 1-bromo-3,5-bis(1,1-dimethylethyl)- |
| 3,5-di-tert-Bu-bromobenzene |
| 1-Bromo-3,5-bis(1,1-dimethylethyl)benzene |
| MFCD00796945 |
| 3,5-di-tert-butyl-1-bromobenzene |
| 1-Bromo-3,5-di-t-butylbenzene |
| 3,5-tert-butyl bromobenzene |