Introduction：Basic information about CAS 32580-72-6|ethyl 3-[2,4-bis(1-methylethyl)phenyl]acrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 3-[2,4-bis(1-methylethyl)phenyl]acrylate |
|---|
| CAS Number | 32580-72-6 | Molecular Weight | 260.37100 |
|---|
| Density | 0.974g/cm3 | Boiling Point | 347.3ºC at 760mmHg |
|---|
| Molecular Formula | C17H24O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.7ºC |
|---|
Names
| Name | ethyl 4-methyl-3-phenyl-2-propan-2-ylpent-2-enoate |
|---|
Chemical & Physical Properties
| Density | 0.974g/cm3 |
|---|
| Boiling Point | 347.3ºC at 760mmHg |
|---|
| Molecular Formula | C17H24O2 |
|---|
| Molecular Weight | 260.37100 |
|---|
| Flash Point | 174.7ºC |
|---|
| Exact Mass | 260.17800 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 4.31530 |
|---|
| Index of Refraction | 1.523 |
|---|
| InChIKey | XRLCQRMNGQRGOC-MDZDMXLPSA-N |
|---|
| SMILES | CCOC(=O)C=Cc1ccc(C(C)C)cc1C(C)C |
|---|
