Introduction:Basic information about CAS 3736-92-3|1,2-diphenyl-4-(2-phenylthioethyl)pyrazolidine-3,5-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-diphenyl-4-(2-phenylthioethyl)pyrazolidine-3,5-dione |
|---|
| CAS Number | 3736-92-3 | Molecular Weight | 388.48200 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 538ºC at 760mmHg |
|---|
| Molecular Formula | C23H20N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 279.2ºC |
|---|
Names
| Name | 1,2-diphenyl-4-(2-phenylsulfanylethyl)pyrazolidine-3,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 538ºC at 760mmHg |
|---|
| Molecular Formula | C23H20N2O2S |
|---|
| Molecular Weight | 388.48200 |
|---|
| Flash Point | 279.2ºC |
|---|
| Exact Mass | 388.12500 |
|---|
| PSA | 65.92000 |
|---|
| LogP | 4.91000 |
|---|
| Index of Refraction | 1.697 |
|---|
| InChIKey | PLGXGMUJUXKCDD-UHFFFAOYSA-N |
|---|
| SMILES | O=C1C(CCSc2ccccc2)C(=O)N(c2ccccc2)N1c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,2-Diphenyl-4-(2-phenylmercapto-aethyl)-pyrazolidin-3,5-dion |
| 3,5-Pyrazolidinedione,1,2-diphenyl-4-(2-(phenylthio)ethyl) |
| EINECS 223-109-7 |
| 1,2-Diphenyl-4-phenylthioethyl-3,5-pyrazolidinedione |
| 1,2-diphenyl-4-[2-(phenylthio)ethyl]-3,5-pyrazolidinedione |
| 1,2-diphenyl-4-(2-phenylsulfanyl-ethyl)-pyrazolidine-3,5-dione |
| Sulfinpyrazone sulfide |
| 4-[2-(phenylthio)ethyl]-1,2-diphenyl-3,5-pyrazolidinedione |
| 4-(Phenylthioethyl)-1,2-diphenyl-3,5-pyrazolidine-dione |
| 1,2-Diphenyl-4-(2-phenylthioethyl)pyrazolidine-3,5-dione |