Introduction：Basic information about CAS 22679-54-5|4-tert-butylbenzophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-tert-butylbenzophenone |
|---|
| CAS Number | 22679-54-5 | Molecular Weight | 238.32400 |
|---|
| Density | 1.017g/cm3 | Boiling Point | 168-170°C 2mm |
|---|
| Molecular Formula | C17H18O | Melting Point | 38-40°C |
|---|
| MSDS | USA | Flash Point | 150°C |
|---|
Names
| Name | (4-tert-butylphenyl)-phenylmethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.017g/cm3 |
|---|
| Boiling Point | 168-170°C 2mm |
|---|
| Melting Point | 38-40°C |
|---|
| Molecular Formula | C17H18O |
|---|
| Molecular Weight | 238.32400 |
|---|
| Flash Point | 150°C |
|---|
| Exact Mass | 238.13600 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.21510 |
|---|
| Vapour Pressure | 5.3E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | DFYJCXSOGSYMAJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1ccc(C(=O)c2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 43 |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| HS Code | 2914399090 |
|---|
Customs
| HS Code | 2914399090 |
|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| MFCD00017255 |
| p-tert-butylbenzophenone |
| EINECS 245-154-1 |
| 4-tBuC6H4COPh |
| 4-tert-Butylbenzophenone |
