Introduction：Basic information about CAS 6247-27-4|mordant brown 4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | mordant brown 4 |
|---|
| CAS Number | 6247-27-4 | Molecular Weight | 332.27200 |
|---|
| Density | 1.704g/cm3 | Boiling Point | 596.162ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12N6O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 314.348ºC |
|---|
Names
| Name | (6E)-6-[(2,4-diamino-5-methylphenyl)hydrazinylidene]-2,4-dinitrocyclohexa-2,4-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.704g/cm3 |
|---|
| Boiling Point | 596.162ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12N6O5 |
|---|
| Molecular Weight | 332.27200 |
|---|
| Flash Point | 314.348ºC |
|---|
| Exact Mass | 332.08700 |
|---|
| PSA | 185.14000 |
|---|
| LogP | 3.11300 |
|---|
| Index of Refraction | 1.748 |
|---|
| InChIKey | ZQOQTVZVXAHHAW-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(N=Nc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)c(N)cc1N |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
Synonyms
| Metachrombraun B |
| Alizarol Brown RB |
| EINECS 228-362-7 |
| mordant brown 4 |
| 3'.5'-Dinitro-4.6-diamino-2'-oxy-3-methyl-azobenzol |
