Introduction:Basic information about CAS 62476-60-2|N-(2,4-dimethyl-5-nitrophenyl)acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(2,4-dimethyl-5-nitrophenyl)acetamide |
|---|
| CAS Number | 62476-60-2 | Molecular Weight | 208.21400 |
|---|
| Density | 1.247g/cm3 | Boiling Point | 369.1ºC at 760 mmHg |
|---|
| Molecular Formula | C10H12N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177ºC |
|---|
Names
| Name | N-(2,4-dimethyl-5-nitrophenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.247g/cm3 |
|---|
| Boiling Point | 369.1ºC at 760 mmHg |
|---|
| Molecular Formula | C10H12N2O3 |
|---|
| Molecular Weight | 208.21400 |
|---|
| Flash Point | 177ºC |
|---|
| Exact Mass | 208.08500 |
|---|
| PSA | 78.41000 |
|---|
| LogP | 3.34270 |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | LVADKDJSNQETBO-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1cc([N+](=O)[O-])c(C)cc1C |
|---|
Synonyms
| 2,4-Dimethyl-5-nitroacetanilide |
| 4-Acetamido-6-nitro-1,3-xylene |
| EINECS 263-561-2 |
| 5-nitro-2,4-dimethylacetanilide |
| 6-Nitro-4-acetamino-m-xylol |