Introduction：Basic information about CAS 62637-98-3|2-(Phenylazo)-1-naphthalenol acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(Phenylazo)-1-naphthalenol acetate |
|---|
| CAS Number | 62637-98-3 | Molecular Weight | 290.31600 |
|---|
| Density | 1.16g/cm3 | Boiling Point | 470.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211ºC |
|---|
Names
| Name | (2-phenyldiazenylnaphthalen-1-yl) acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.16g/cm3 |
|---|
| Boiling Point | 470.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14N2O2 |
|---|
| Molecular Weight | 290.31600 |
|---|
| Flash Point | 211ºC |
|---|
| Exact Mass | 290.10600 |
|---|
| PSA | 51.02000 |
|---|
| LogP | 5.18050 |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | FWOUKWJGRCTXND-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1c(N=Nc2ccccc2)ccc2ccccc12 |
|---|
Synonyms
| 2-Phenylazo-1-acetoxy-naphthalin |
| Acetic acid 2-phenylazo-naphthalen-1-yl ester |
