Introduction：Basic information about CAS 561297-83-4|Quinoline, 1,2,3,4-tetrahydro-4,4-dimethyl-7-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Quinoline, 1,2,3,4-tetrahydro-4,4-dimethyl-7-nitro- |
|---|
| CAS Number | 561297-83-4 | Molecular Weight | 206.24100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H14N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4,4-Dimethyl-7-nitro-1,2,3,4-tetrahydroquinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H14N2O2 |
|---|
| Molecular Weight | 206.24100 |
|---|
| Exact Mass | 206.10600 |
|---|
| PSA | 57.85000 |
|---|
| LogP | 3.34920 |
|---|
| InChIKey | RNOVBVJBXRNABJ-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)CCNc2cc([N+](=O)[O-])ccc21 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,2,3,4-tetrahydro-4,4-dimethyl-7-nitroquinoline |
| 1-Naphthalenol,1,2,3,4-tetrahydro-4,4-dimethyl |
| 4,4-dimethyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| 1,2,3,4-tetrahydro-4,4-dimethyl-1-naphthol |
| 4,4-dimethyl-1-tetralol |
| 4,4-Dimethyl-2-hydroxy-1,2,3,4-tetrahydronaphthalin |
| 4,4-dimethyl-7-nitro-1,2,3,4-tetrahydro-quinoline |
| dimethyl-4,4 tetralol |
