Introduction：Basic information about CAS 88511-57-3|4-amino-3-nitropyridin-2-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-amino-3-nitropyridin-2-ol |
|---|
| CAS Number | 88511-57-3 | Molecular Weight | 155.111 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 457.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C5H5N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.5±27.3 °C |
|---|
Names
| Name | 4-Amino-2-hydroxy-3-nitropyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 457.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C5H5N3O3 |
|---|
| Molecular Weight | 155.111 |
|---|
| Flash Point | 230.5±27.3 °C |
|---|
| Exact Mass | 155.033096 |
|---|
| PSA | 104.96000 |
|---|
| LogP | 0.53 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.705 |
|---|
| InChIKey | RGLDNSAKBSIEHN-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc[nH]c(=O)c1[N+](=O)[O-] |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-Amino-3-nitro-2-hydroxypyridine |
| 4-amino-3-nitropyridin-2(1H)-one |
| 4-aMino-3-nitro |
| 4-Amino-3-nitro-2(1H)-pyridinone |
| 4-Amino-3-nitropyridin-2(1H)-on |
| 2-Hydroxy-3-nitro-4-amino-pyridin |
| 2-Hydroxy-3-Nitro-4-Aminopyridine |
| 2(1H)-Pyridinone, 4-amino-3-nitro- |
| 4-amino-3-nitropyridin-2-ol |
| 4-amino-3-nitro-2-pyridinol |
