Introduction：Basic information about CAS 41543-92-4|N-(4-Anilinophenyl)-Methacrylamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(4-Anilinophenyl)-Methacrylamide |
|---|
| CAS Number | 41543-92-4 | Molecular Weight | 252.31100 |
|---|
| Density | 1.165g/cm3 | Boiling Point | 464.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 180ºC |
|---|
Names
| Name | N-(4-anilinophenyl)-2-methylprop-2-enamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.165g/cm3 |
|---|
| Boiling Point | 464.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16N2O |
|---|
| Molecular Weight | 252.31100 |
|---|
| Flash Point | 180ºC |
|---|
| Exact Mass | 252.12600 |
|---|
| PSA | 41.13000 |
|---|
| LogP | 4.09080 |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | GFSJJVJWCAMZEV-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C(=O)Nc1ccc(Nc2ccccc2)cc1 |
|---|
Synonyms
| einecs 255-432-4 |
| N-(4-Anilinophenyl)-Methacrylamide |
| 2-Methyl-N-[4-(Phenylamino)Phenyl]Acrylamide |
| N-(4-(Phenylamino)Phenyl)Methacrylamide |
