Introduction：Basic information about CAS 103918-73-6|[2-(Phenylsulfanyl)-5-propionylphenyl]acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [2-(Phenylsulfanyl)-5-propionylphenyl]acetic acid |
|---|
| CAS Number | 103918-73-6 | Molecular Weight | 300.372 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 477.7±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H16O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 242.7±31.5 °C |
|---|
Names
| Name | 2-(2-phenylsulfanyl-5-propanoylphenyl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 477.7±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H16O3S |
|---|
| Molecular Weight | 300.372 |
|---|
| Flash Point | 242.7±31.5 °C |
|---|
| Exact Mass | 300.082001 |
|---|
| PSA | 79.67000 |
|---|
| LogP | 1.74 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | OIDXFJQJYOGXHS-UHFFFAOYSA-N |
|---|
| SMILES | CCC(=O)c1ccc(Sc2ccccc2)c(CC(=O)O)c1 |
|---|
Synonyms
| 1-Propanone, 1-[5-[2-(acetyloxy)phenyl]-4-thioxo-1,5-cyclohexadien-1-yl]- |
| 2-phenylthio-5-propionyl phenyl acetic acid(Zaltoprofen intermediate) |
| 2-(3-Propionyl-6-thioxo-1,3-cyclohexadien-1-yl)phenyl acetate |
| [2-(Phenylsulfanyl)-5-propionylphenyl]acetic acid |
| Benzeneacetic acid, 5-(1-oxopropyl)-2-(phenylthio)- |
| 2-phenylthio-5-propionylphenylacetic acid |
