Introduction:Basic information about CAS 88578-92-1|2-chloro-4-fluorobenzotrichloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-chloro-4-fluorobenzotrichloride |
|---|
| CAS Number | 88578-92-1 | Molecular Weight | 247.90900 |
|---|
| Density | 1.579g/cm3 | Boiling Point | 256.9ºC at 760 mmHg |
|---|
| Molecular Formula | C7H3Cl4F | Melting Point | / |
|---|
| MSDS | / | Flash Point | 121.9ºC |
|---|
Names
| Name | 2-chloro-4-fluoro-1-(trichloromethyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.579g/cm3 |
|---|
| Boiling Point | 256.9ºC at 760 mmHg |
|---|
| Molecular Formula | C7H3Cl4F |
|---|
| Molecular Weight | 247.90900 |
|---|
| Flash Point | 121.9ºC |
|---|
| Exact Mass | 245.89700 |
|---|
| LogP | 4.30580 |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | VAHJAZWBSMAVQL-UHFFFAOYSA-N |
|---|
| SMILES | Fc1ccc(C(Cl)(Cl)Cl)c(Cl)c1 |
|---|
Synonyms
| 2-chloro-4-fluorobenzotrichloride |
| PC1425 |
| MFCD06658254 |
| 2-Chloro-4-fluorobenzotrichoride |