Introduction:Basic information about CAS 2388-32-1|2-Chloro quinoline-4-chloroformyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro quinoline-4-chloroformyl |
|---|
| CAS Number | 2388-32-1 | Molecular Weight | 226.059 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 341.2±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H5Cl2NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160.2±22.3 °C |
|---|
Names
| Name | 2-Chloroquinoline-4-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 341.2±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H5Cl2NO |
|---|
| Molecular Weight | 226.059 |
|---|
| Flash Point | 160.2±22.3 °C |
|---|
| Exact Mass | 224.974823 |
|---|
| PSA | 29.96000 |
|---|
| LogP | 3.13 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | KTMXEEOPGLOPMJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cc(Cl)nc2ccccc12 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-Chloro-quinoline-4-carbonyl chloride |
| 2-Chloro-4-quinolinecarbonyl chloride |
| 4-Quinolinecarbonyl chloride, 2-chloro- |
| 2-Chlor-chinolin-4-carbonylchlorid |
| EINECS 219-220-5 |
| 2-Chloro-4-quinolinecarboxylic acid chloride |
| 2-Chloro-4-chlorocarbonylquinoline |
| 2-Chloro quinoline-4-chloroformyl |
| MFCD06654888 |
| 2-chloroquinoline-4-carbonyl chloride |