Introduction：Basic information about CAS 88-49-3|4-chloro-2,5-dimethylbenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-chloro-2,5-dimethylbenzenesulfonyl chloride |
|---|
| CAS Number | 88-49-3 | Molecular Weight | 239.11900 |
|---|
| Density | 1.401g/cm3 | Boiling Point | 317.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8Cl2O2S | Melting Point | 48 °C |
|---|
| MSDS | USA | Flash Point | 145.8ºC |
|---|
Names
| Name | 4-chloro-2,5-dimethylbenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.401g/cm3 |
|---|
| Boiling Point | 317.5ºC at 760 mmHg |
|---|
| Melting Point | 48 °C |
|---|
| Molecular Formula | C8H8Cl2O2S |
|---|
| Molecular Weight | 239.11900 |
|---|
| Flash Point | 145.8ºC |
|---|
| Exact Mass | 237.96200 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 3.96510 |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | JBYZPUBAISWVDI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(S(=O)(=O)Cl)c(C)cc1Cl |
|---|
Safety Information
| Hazard Codes | Xi: Irritant;C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | 3261 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-Chlor-2,5-dimethyl-benzolsulfonylchlorid |
| 4-chloro-2,5-dimethylphenylsulfonyl chloride |
| 5-Chloro-p-xylene-2-sulphonyl chloride |
| EINECS 201-835-5 |
| 5-chloro-p-xylene-2-sulfonyl chloride |
| 4-Chloro-2,5-dimethylbenzene-1-sulfonyl chloride |
| 4-chloro-2,5-dimethyl-benzenesulfonyl chloride |
| chloro(4-chloro-2,5-dimethylphenyl)sulfone |
| MFCD00044017 |
