Introduction：Basic information about CAS 221136-66-9|3-Bromo-6-methyl-2-oxo-1(2H)-pyrazineacetic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Bromo-6-methyl-2-oxo-1(2H)-pyrazineacetic acid ethyl ester |
|---|
| CAS Number | 221136-66-9 | Molecular Weight | 275.09900 |
|---|
| Density | 1.55g/cm3 | Boiling Point | 338.3ºC at 760mmHg |
|---|
| Molecular Formula | C9H11BrN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 158.4ºC |
|---|
Names
| Name | ethyl 2-(3-bromo-6-methyl-2-oxopyrazin-1-yl)acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.55g/cm3 |
|---|
| Boiling Point | 338.3ºC at 760mmHg |
|---|
| Molecular Formula | C9H11BrN2O3 |
|---|
| Molecular Weight | 275.09900 |
|---|
| Flash Point | 158.4ºC |
|---|
| Exact Mass | 273.99500 |
|---|
| PSA | 61.19000 |
|---|
| LogP | 0.87730 |
|---|
| Vapour Pressure | 9.89E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | NHAOOSRGGOXZGW-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)Cn1c(C)cnc(Br)c1=O |
|---|
Synonyms
| ethyl 3-bromo-6-methylpyrazin-2-one-1-acetate |
| 3-bromo-6-methyl-1-(ethoxycarbonylmethyl)pyrazinone |
| 3-bromo-1-(ethoxycarbonylmethyl)-6-methylpyrazinone |
| (3-bromo-6-methyl-2-oxo-2H-pyrazin-1-yl)-acetic acid ethyl ester |
| 3-Bromo-6-methyl-2-oxo-1(2H)-pyrazineacetic acid ethyl ester |
| ethyl 3-bromo-6-methylpyrazin-(1H)-2-one-1-acetate |
