CAS 7422-52-8|(3-glycidoxypropyl)bis(trimethylsiloxy)methylsilane
Introduction：Basic information about CAS 7422-52-8|(3-glycidoxypropyl)bis(trimethylsiloxy)methylsilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3-glycidoxypropyl)bis(trimethylsiloxy)methylsilane | ||
|---|---|---|---|
| CAS Number | 7422-52-8 | Molecular Weight | 336.647 |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 318.4±48.0 °C at 760 mmHg |
| Molecular Formula | C13H32O4Si3 | Melting Point | / |
| MSDS | / | Flash Point | 125.1±30.0 °C |
Names
| Name | trimethyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilane |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.4±48.0 °C at 760 mmHg |
| Molecular Formula | C13H32O4Si3 |
| Molecular Weight | 336.647 |
| Flash Point | 125.1±30.0 °C |
| Exact Mass | 336.160828 |
| PSA | 40.22000 |
| LogP | 4.88 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.436 |
| InChIKey | YSIQPJVFCSCUMU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(CCCOCC1CO1)O[Si](C)(C)C |
Safety Information
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2934999090 |
Customs
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
Synonyms
| 1,1,1,3,5,5,5-Heptamethyl-3-(3-glycidyloxypropyl)trisiloxane |
| 3-(glycidyloxypropyl)-1,1,1,3,5,5,5-heptamethyltrisiloxane |
| EINECS 231-045-6 |
| 1-SI-1&1&O-SI-1&O-SI-1&1&1&&3O1- BT3OTJ |
| H1266 |
| Trisiloxane, 1,1,1,3,5,5,5-heptamethyl-3-[3-(oxiranylmethoxy)propyl]- |
| (3-Glycidoxypropyl)bis(trimethylsiloxy)methylsilane |
| 3-[3-(2,3-epoxy-propoxy)-propyl]-1,1,1,3,5,5,5-heptamethyl-trisiloxane |
| 1,1,1,3,5,5,5-Heptamethyl-3-(3-(oxiranylmethoxy)propyl)trisiloxane |
| 3-[3-(2,3-Epoxy-propoxy)-propyl]-1,1,1,3,5,5,5-heptamethyl-trisiloxan |
| Trisiloxane,1,1,1,3,5,5,5-heptamethyl-3-(3-(2-oxiranylmethoxy)propyl) |
| 1,1,1,3,5,5,5-Heptamethyl-3-[3-(2-oxiranylmethoxy)propyl]trisiloxane |
| 3-(glycidoxypropyl) heptamethyltrisiloxane |
| 3-(3-glycidyloxypropyl)heptamethyltrisiloxane |
| 1,1,1,3,5,5,5-Heptamethyl-3-[3-(oxiran-2-ylmethoxy)propyl]trisiloxane |
