Introduction：Basic information about CAS 88-39-1|Benzaldehyde-2,4-disulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzaldehyde-2,4-disulfonic acid |
|---|
| CAS Number | 88-39-1 | Molecular Weight | 266.24800 |
|---|
| Density | 1.815 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H6O7S2 | Melting Point | 105-107°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-formylbenzene-1,3-disulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.815 g/cm3 |
|---|
| Melting Point | 105-107°C |
|---|
| Molecular Formula | C7H6O7S2 |
|---|
| Molecular Weight | 266.24800 |
|---|
| Exact Mass | 265.95500 |
|---|
| PSA | 142.57000 |
|---|
| LogP | 2.15410 |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | PQYVGRGYAZDHFY-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| Packaging Group | II |
|---|
| HS Code | 2913000090 |
|---|
Customs
| HS Code | 2913000090 |
|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| EINECS 201-826-6 |
| 4-Formylbenzene-1,3-disulphonic acid |
| 2,4-disulfobenzaldehyde |
| Benzaldehyd-disulfonsaeure-(2.4) |
| 4-formyl-benzene-1,3-disulfonic acid |
| 2,4-disulphobenzaldehyde |
| 1,3-Benzenedisulfonicacid,4-formyl |
| 4-formyl-1,3-benzenedisulfonic acid |
| MFCD00450438 |
| benzaldehyde-2,4-disulfonic acid |
| 4-Formyl-benzol-1,3-disulfonsaeure |
