Introduction:Basic information about CAS 76656-36-5|Disodium 2,2'-dihydroxy-4,4'-dimethoxy-5,5'-disulfobenzophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Disodium 2,2'-dihydroxy-4,4'-dimethoxy-5,5'-disulfobenzophenone |
|---|
| CAS Number | 76656-36-5 | Molecular Weight | 478.359 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H12Na2O11S2 | Melting Point | 350°C (dec.) |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | disodium,4-hydroxy-5-(2-hydroxy-4-methoxy-5-sulfonatobenzoyl)-2-methoxybenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 350°C (dec.) |
|---|
| Molecular Formula | C15H12Na2O11S2 |
|---|
| Molecular Weight | 478.359 |
|---|
| Exact Mass | 477.961639 |
|---|
| PSA | 207.15000 |
|---|
| LogP | 2.31580 |
|---|
| InChIKey | QDCHWIWENYCPIL-UHFFFAOYSA-L |
|---|
| SMILES | COc1cc(O)c(C(=O)c2cc(S(=O)(=O)[O-])c(OC)cc2O)cc1S(=O)(=O)[O-].[Na+].[Na+] |
|---|
| Storage condition | 2-8℃ |
|---|
Safety Information
| Hazard Codes | F,Xi |
|---|
| Risk Phrases | R11:Highly Flammable. R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S16-S26-S36-S7/9 |
|---|
| RIDADR | UN 1325 4.1/PG 2 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| MFCD02683831 |
| Benzenesulfonic acid, 3,3'-carbonylbis[4-hydroxy-6-methoxy-, sodium salt (1:2) |
| disodium 4-hydroxy-5-(2-hydroxy-4-methoxy-5-sulfonatobenzoyl)-2-methoxybenzenesulfonate |
| Uvinuc ds 49 |
| UNII-7925W14T4L |
| 2,2'-Dihydroxy-4,4'-dimethoxybenzophenone-5,5'-disulphonic acid sodium salt |
| Disodium 2,2'-dihydroxy-4,4'-dimethoxy-5,5'-disulfobenzophenone |
| EINECS 278-520-4 |
| Disodium 3,3'-carbonylbis(4-hydroxy-6-methoxybenzenesulfonate) |